Dataset
Acyclovir; LC-ESI-Q; MS; POS; 30 V
Chemical Information
| InChI | InChI=1S/C8H11N5O3/c9-8-11-6-5(7(15)12-8)10-3-13(6)4-16-2-1-14/h3,14H,1-2,4H2,(H3,9,11,12,15) |
|---|---|
| SMILES | OCCOCn(c2)c(N1)c(n2)C(=O)N=C(N)1 |
| InChI Key | MKUXAQIIEYXACX-UHFFFAOYSA-N |
| Molecular Formula | C8H11N5O3 |
| Exact Mass | 225.086 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | https://creativecommons.org/licenses/by-nc/4.0 |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-Waters-WA001205 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataPublished | 2016-01-19 |
| Related Molecule |
|
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| DB00787 | drugbank |
| CHEBI:2453 | chebi |
| AC2 | rcsb_pdb |
| CHEMBL184 | chembl |
| 3175 | surechembl |
| 40723 | surechembl |
| 9828560 | surechembl |
| 135398513 | pubchem |
| X4HES1O11F | fdasrs |
| 4829 | gtopdb |
| PD000980 | probes_and_drugs |
| MECWIC | CCDC |
| 153377 | brenda |
| 154360 | brenda |
| 166474 | brenda |
| 173055 | brenda |
| 17698 | brenda |
| 3062 | brenda |
| 4406 | brenda |
| AC2 | pdbe |
| HMDB0014925 | hmdb |
| DTXSID1022556 | comptox |
| NCT00158483 | clinicaltrials |
| NCT00194519 | clinicaltrials |
| NCT00467662 | clinicaltrials |
| NCT00469300 | clinicaltrials |
| NCT00769314 | clinicaltrials |
| NCT01010698 | clinicaltrials |
| NCT01281007 | clinicaltrials |
| NCT01327144 | clinicaltrials |
| NCT01503918 | clinicaltrials |
| NCT01574612 | clinicaltrials |
| NCT02152358 | clinicaltrials |
| NCT02205489 | clinicaltrials |
| NCT02265913 | clinicaltrials |
| NCT02483182 | clinicaltrials |
| NCT02633332 | clinicaltrials |
| NCT02871492 | clinicaltrials |
| NCT03443869 | clinicaltrials |
| NCT06228430 | clinicaltrials |
| Molport-000-768-994 | molport |
| Molport-001-889-834 | molport |
| Molport-003-940-063 | molport |
| 85 | drugcentral |
| 50021776 | bindingdb |
| 50103518 | bindingdb |
| The data in this table is sourced from UniChem at EBI. | |