Dataset
Methimazole; LC-ESI-Q; MS; POS; 15 V, 30 V
Chemical Information
| InChI | InChI=1S/C4H6N2S/c1-6-3-2-5-4(6)7/h2-3H,1H3,(H,5,7) |
|---|---|
| SMILES | Cn(c1)c(S)nc1 |
| InChI Key | PMRYVIKBURPHAH-UHFFFAOYSA-N |
| Molecular Formula | C4H6N2S |
| Exact Mass | 114.025 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | https://creativecommons.org/licenses/by-nc/4.0 |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-Waters-WA001413 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataPublished | 2016-01-19 |
| Related Molecule |
|
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| 1349907 | PubChem |
| 15194357 | PubChem: Thomson Pharma |
| PD000229 | ProbesDrugs |
| CB71121723 | ChemicalBook |
| methimazole | Atlas |
| 15297082 | PubChem: Thomson Pharma |
| LSM-5646 | LINCS |
| PA450422 | PharmGKB |
| Methimazole(Tapazole) | Selleck |
| 554Z48XN5E | FDA SRS |
| 496094 | eMolecules |
| 1971965 | eMolecules |
| 30541 | Brenda |
| 32678 | Brenda |
| 104592 | Brenda |
| methimazole | DailyMed |
| HMDB0014901 | Human Metabolome Database |
| CB9220870 | ChemicalBook |
| 90546 | Brenda |
| SCHEMBL41647 | SureChEMBL |
| 50673 | ChEBI |
| MCULE-9902292741 | Mcule |
| CHEMBL1515 | ChEMBL |
| DB00763 | DrugBank |
| SAM002548951 | NIH Clinical Collection |
| MMZ | PDBe |
| C07190 | KEGG Ligand |
| TAPAZOLE | rxnorm |
| METHIMAZOLE | rxnorm |
| TAPAZOLE | clinicaltrials |
| THIAMAZOLE | clinicaltrials |
| METHIMAZOLE | clinicaltrials |
| HY-B0208 | MedChemExpress |
| 1144 | Brenda |
| 90547 | Brenda |
| 42919 | Brenda |
| DTXSID4020820 | EPA CompTox Dashboard |
| 1745 | DrugCentral |
| ZINC000001187543 | ZINC |
| 6649 | Guide to Pharmacology |
| J1.400A | Nikkaji |
| BULCUG | CCDC |
| 50241361 | BindingDB |
| METHIMAZOLE | DailyMed |
| The data in this table is sourced from UniChem at EBI. | |