Dataset
Imidapril; LC-ESI-Q; MS; POS; 30 V
Chemical Information
| InChI | InChI=1S/C20H27N3O6/c1-4-29-19(27)15(11-10-14-8-6-5-7-9-14)21-13(2)17(24)23-16(18(25)26)12-22(3)20(23)28/h5-9,13,15-16,21H,4,10-12H2,1-3H3,(H,25,26)/t13-,15-,16-/m0/s1 |
|---|---|
| SMILES | CCOC(=O)C(CCc(c2)cccc2)NC(C)C(=O)N(C(=O)1)C(C(O)=O)CN(C)1 |
| InChI Key | KLZWOWYOHUKJIG-BPUTZDHNSA-N |
| Molecular Formula | C20H27N3O6 |
| Exact Mass | 405.190 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | https://creativecommons.org/licenses/by-nc/4.0 |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-Waters-WA001452 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataPublished | 2016-01-19 |
| Related Molecule |
|
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| DB11783 | DrugBank |
| ZINC000003784427 | ZINC |
| CB1780943 | ChemicalBook |
| HMDB0041907 | Human Metabolome Database |
| 40466903 | PubChem |
| SCHEMBL34098 | SureChEMBL |
| 5464343 | PubChem |
| PD013736 | ProbesDrugs |
| BW7H1TJS22 | FDA SRS |
| 14855044 | PubChem: Thomson Pharma |
| imidapril-tanatril | Selleck |
| 89371-37-9 | ACToR |
| 6843155 | eMolecules |
| CHEMBL317094 | ChEMBL |
| CB81009271 | ChemicalBook |
| 1424 | DrugCentral |
| IMIDAPRIL | rxnorm |
| IMIDAPRIL | clinicaltrials |
| DTXSID2048242 | EPA CompTox Dashboard |
| 50020400 | BindingDB |
| 135654 | ChEBI |
| J325.987K | Nikkaji |
| 6377 | Guide to Pharmacology |
| The data in this table is sourced from UniChem at EBI. | |