Dataset
Guaifenesin; LC-ESI-Q; MS; POS; 60 V, 90 V
Chemical Information
| InChI | InChI=1S/C10H14O4/c1-13-9-4-2-3-5-10(9)14-7-8(12)6-11/h2-5,8,11-12H,6-7H2,1H3 |
|---|---|
| SMILES | OCC(O)COc(c1)c(OC)ccc1 |
| InChI Key | HSRJKNPTNIJEKV-UHFFFAOYSA-N |
| Molecular Formula | C10H14O4 |
| Exact Mass | 198.089 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | https://creativecommons.org/licenses/by-nc/4.0 |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-Waters-WA001459 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataPublished | 2016-01-19 |
| Related Molecule |
|
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| 7617 | Guide to Pharmacology |
| 1336 | DrugCentral |
| 5551 | ChEBI |
| DTXSID5023114 | EPA CompTox Dashboard |
| 495W7451VQ | FDA SRS |
| HY-B0264 | MedChemExpress |
| 50240098 | BindingDB |
| GUAIFENESIN | rxnorm |
| MUCINEX | rxnorm |
| GUAIFENESIN | DailyMed |
| J3.936E | Nikkaji |
| ROBITUSSIN | clinicaltrials |
| MUCINEX | clinicaltrials |
| GUAIFENESIN | clinicaltrials |
| DB00874 | DrugBank |
| CHEMBL980 | ChEMBL |
| 14773055 | PubChem: Thomson Pharma |
| 3516 | PubChem |
| PD002316 | ProbesDrugs |
| CB3649080 | ChemicalBook |
| LSM-1896 | LINCS |
| 93-14-1 | ACToR |
| SCHEMBL4321 | SureChEMBL |
| Guaifenesin(Guaiphenesin) | Selleck |
| PA449818 | PharmGKB |
| 12041-73-5 | ACToR |
| 538761 | eMolecules |
| HMDB0004998 | Human Metabolome Database |
| CB1743199 | ChemicalBook |
| guaifenesin | DailyMed |
| MCULE-8909929116 | Mcule |
| 20143234 | NMRShiftDB |
| The data in this table is sourced from UniChem at EBI. | |