Dataset
Benserazide; LC-ESI-Q; MS; POS; 30 V
Chemical Information
| InChI | InChI=1S/C10H15N3O5/c11-6(4-14)10(18)13-12-3-5-1-2-7(15)9(17)8(5)16/h1-2,6,12,14-17H,3-4,11H2,(H,13,18) |
|---|---|
| SMILES | OCC(N)C(=O)NNCc(c1)c(O)c(O)c(O)c1 |
| InChI Key | BNQDCRGUHNALGH-UHFFFAOYSA-N |
| Molecular Formula | C10H15N3O5 |
| Exact Mass | 257.101 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | https://creativecommons.org/licenses/by-nc/4.0 |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-Waters-WA001797 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataPublished | 2016-01-19 |
| Related Molecule |
|
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| 2327 | PubChem |
| 15094804 | PubChem: Thomson Pharma |
| PD013354 | ProbesDrugs |
| SCHEMBL34522 | SureChEMBL |
| benserazide | Atlas |
| LSM-5097 | LINCS |
| 322-35-0 | ACToR |
| 64187 | ChEBI |
| 1935102 | eMolecules |
| PA165360203 | PharmGKB |
| 96905 | Brenda |
| 147310 | Brenda |
| DB12783 | DrugBank |
| SCHEMBL20509005 | SureChEMBL |
| BENSERAZIDE | rxnorm |
| BENSERAZIDE | clinicaltrials |
| RO 4-4602 | clinicaltrials |
| RO-4-4602 | clinicaltrials |
| 10586 | Brenda |
| 49122 | BindingDB |
| DTXSID9022651 | EPA CompTox Dashboard |
| 314 | DrugCentral |
| 5150 | Guide to Pharmacology |
| J30.692D | Nikkaji |
| HMDB0248960 | Human Metabolome Database |
| 762OS3ZEJU | FDA SRS |
| 96907 | Brenda |
| CB3384419 | ChemicalBook |
| CHEMBL1096979 | ChEMBL |
| The data in this table is sourced from UniChem at EBI. | |