Dataset
Nadolol; LC-ESI-Q; MS; POS; 75 V
Chemical Information
| InChI | InChI=1S/C17H27NO4/c1-17(2,3)18-9-12(19)10-22-16-6-4-5-11-7-14(20)15(21)8-13(11)16/h4-6,12,14-15,18-21H,7-10H2,1-3H3/t12?,14-,15+/m1/s1 |
|---|---|
| SMILES | OC(CNC(C)(C)C)COc(c2)c(C1)c(cc2)CC(O)C(O)1 |
| InChI Key | VWPOSFSPZNDTMJ-UCWKZMIHSA-N |
| Molecular Formula | C17H27NO4 |
| Exact Mass | 309.194 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | https://creativecommons.org/licenses/by-nc/4.0 |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-Waters-WA001899 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataPublished | 2016-01-19 |
| Related Molecule |
|
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| 554 | Guide to Pharmacology |
| 12013396 | PubChem: Drugs of the Future |
| DB01203 | DrugBank |
| SAM002264627 | NIH Clinical Collection |
| CHEMBL649 | ChEMBL |
| SQ-11725 | clinicaltrials |
| FEN504330V | FDA SRS |
| DTXSID3023342 | EPA CompTox Dashboard |
| 25766 | BindingDB |
| NADOLOL | DailyMed |
| NADOLOL | rxnorm |
| CORGARD | rxnorm |
| NADOLOL | clinicaltrials |
| CORGARD | clinicaltrials |
| CB2494641 | ChemicalBook |
| 39147 | PubChem |
| PD001017 | ProbesDrugs |
| LSM-1879 | LINCS |
| 42200-33-9 | ACToR |
| PA450573 | PharmGKB |
| SCHEMBL4177 | SureChEMBL |
| 3716096 | eMolecules |
| HMDB0015334 | Human Metabolome Database |
| nadolol | DailyMed |
| The data in this table is sourced from UniChem at EBI. | |