Dataset
Sultopride; LC-ESI-Q; MS; POS; 45 V
Chemical Information
| InChI | InChI=1S/C17H26N2O4S/c1-4-19-10-6-7-13(19)12-18-17(20)15-11-14(24(21,22)5-2)8-9-16(15)23-3/h8-9,11,13H,4-7,10,12H2,1-3H3,(H,18,20) |
|---|---|
| SMILES | CCN(C2)C(CC2)CNC(=O)c(c(OC)1)cc(cc1)S(=O)(=O)CC |
| InChI Key | UNRHXEPDKXPRTM-UHFFFAOYSA-N |
| Molecular Formula | C17H26N2O4S |
| Exact Mass | 354.161 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | https://creativecommons.org/licenses/by-nc/4.0 |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-Waters-WA002171 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataPublished | 2016-01-19 |
| Related Molecule |
|
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| 5357 | PubChem |
| PD014091 | ProbesDrugs |
| 14803104 | PubChem: Thomson Pharma |
| SCHEMBL149197 | SureChEMBL |
| 53583-79-2 | ACToR |
| 1989123 | eMolecules |
| 9356 | ChEBI |
| DTXSID9023627 | EPA CompTox Dashboard |
| SULTOPRIDE | rxnorm |
| J10.063C | Nikkaji |
| SULTOPRIDE | clinicaltrials |
| 86720 | BindingDB |
| HY-42849 | MedChemExpress |
| AA0G3TW31W | FDA SRS |
| HMDB0258623 | Human Metabolome Database |
| 2541 | DrugCentral |
| DB13273 | DrugBank |
| 12013423 | PubChem: Drugs of the Future |
| CHEMBL277945 | ChEMBL |
| C11708 | KEGG Ligand |
| The data in this table is sourced from UniChem at EBI. | |