Dataset
Pimozide; LC-ESI-Q; MS; POS; 60 V
Chemical Information
| InChI | InChI=1S/C28H29F2N3O/c29-22-11-7-20(8-12-22)25(21-9-13-23(30)14-10-21)4-3-17-32-18-15-24(16-19-32)33-27-6-2-1-5-26(27)31-28(33)34/h1-2,5-14,24-25H,3-4,15-19H2,(H,31,34) |
|---|---|
| SMILES | C(C1N(C(=O)5)c(c4)c(N5)ccc4)CN(CCCC(c(c3)ccc(c3)F)c(c2)ccc(c2)F)CC1 |
| InChI Key | YVUQSNJEYSNKRX-UHFFFAOYSA-N |
| Molecular Formula | C28H29F2N3O |
| Exact Mass | 461.228 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | https://creativecommons.org/licenses/by-nc/4.0 |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-Waters-WA002193 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataPublished | 2016-01-19 |
| Related Molecule |
|
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| 593283 | eMolecules |
| 14882544 | PubChem: Thomson Pharma |
| PA450965 | PharmGKB |
| 16362 | PubChem |
| 2062-78-4 | ACToR |
| LSM-2001 | LINCS |
| 1HIZ4DL86F | FDA SRS |
| PD001879 | ProbesDrugs |
| SCHEMBL41584 | SureChEMBL |
| MCULE-9624510567 | Mcule |
| 220067 | Brenda |
| ZINC000004175630 | ZINC |
| 72164 | Brenda |
| HMDB0015232 | Human Metabolome Database |
| pimozide | DailyMed |
| CB7290660 | ChemicalBook |
| DB01100 | DrugBank |
| 8212 | ChEBI |
| C07566 | KEGG Ligand |
| 90 | Guide to Pharmacology |
| CHEMBL1423 | ChEMBL |
| 12013418 | PubChem: Drugs of the Future |
| 50334150 | BindingDB |
| PIMOZIDE | DailyMed |
| PIMOZIDE | rxnorm |
| ORAP | rxnorm |
| PIMOZIDE | clinicaltrials |
| 1II | PDBe |
| HY-12987 | MedChemExpress |
| DTXSID8023474 | EPA CompTox Dashboard |
| 2172 | DrugCentral |
| J3.698F | Nikkaji |
| R-6238 | clinicaltrials |
| The data in this table is sourced from UniChem at EBI. | |