Dataset
Niacinamide; LC-ESI-Q; MS; POS; 30 V
Chemical Information
| InChI | InChI=1S/C6H6N2O/c7-6(9)5-2-1-3-8-4-5/h1-4H,(H2,7,9) |
|---|---|
| SMILES | NC(=O)c(c1)cncc1 |
| InChI Key | DFPAKSUCGFBDDF-UHFFFAOYSA-N |
| Molecular Formula | C6H6N2O |
| Exact Mass | 122.048 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | https://creativecommons.org/licenses/by-nc/4.0 |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-Waters-WA002674 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataPublished | 2016-01-19 |
| Related Molecule |
|
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| CHEMBL1140 | ChEMBL |
| 17154 | ChEBI |
| SAM001246860 | NIH Clinical Collection |
| NCA | PDBe |
| 12013393 | PubChem: Drugs of the Future |
| C00153 | KEGG Ligand |
| DB02701 | DrugBank |
| NIACINAMIDE | rxnorm |
| NIACINAMIDE | clinicaltrials |
| NICOTINAMIDE | clinicaltrials |
| HY-B0150 | MedChemExpress |
| DTXSID2020929 | EPA CompTox Dashboard |
| NIACINAMIDE | DailyMed |
| ZINC000000005878 | ZINC |
| J3.988H | Nikkaji |
| NICOAM | CCDC |
| 27507 | BindingDB |
| 1906 | DrugCentral |
| 27678415 | eMolecules |
| HMDB0001406 | Human Metabolome Database |
| CB1130111 | ChemicalBook |
| 17154 | Rhea |
| SCHEMBL19978192 | SureChEMBL |
| niacinamide | DailyMed |
| 137013 | Brenda |
| 163972 | Brenda |
| MTBLC17154 | Metabolights |
| 97464 | Brenda |
| 267 | Brenda |
| 20027731 | NMRShiftDB |
| MCULE-3532732201 | Mcule |
| SCHEMBL2926 | SureChEMBL |
| 123574-63-0 | ACToR |
| PD000511 | ProbesDrugs |
| LSM-5428 | LINCS |
| ncam | Recon |
| Nicotinamide(Niacinamide) | Selleck |
| 15297149 | PubChem: Thomson Pharma |
| 936 | PubChem |
| 25X51I8RD4 | FDA SRS |
| 11032-50-1 | ACToR |
| 98-92-0 | ACToR |
| 490874 | eMolecules |
| The data in this table is sourced from UniChem at EBI. | |