Dataset
Etoposide; LC-ESI-Q; MS; POS; 75 V
Chemical Information
| InChI | InChI=1S/C29H32O13/c1-11-36-9-20-27(40-11)24(31)25(32)29(41-20)42-26-14-7-17-16(38-10-39-17)6-13(14)21(22-15(26)8-37-28(22)33)12-4-18(34-2)23(30)19(5-12)35-3/h4-7,11,15,20-22,24-27,29-32H,8-10H2,1-3H3/t11-,15+,20-,21-,22+,24-,25-,26-,27-,29+/m1/s1 |
|---|---|
| SMILES | c(C(c(c7)cc(OC)c(O)c7OC)4)(c5)c(cc(O6)c5OC6)C(C(C43[H])([H])COC(=O)3)OC(O1)C(C(O)C(O2)([H])C1(COC(C)2)[H])O |
| InChI Key | VJJPUSNTGOMMGY-MRVIYFEKSA-N |
| Molecular Formula | C29H32O13 |
| Exact Mass | 588.184 g/mol |
Data and Resources
Metadata Information
| Field | Value |
|---|---|
| DOI | |
| License URL | https://creativecommons.org/licenses/by-nc/4.0 |
| Source | https://massbank.eu/MassBank/RecordDisplay?id=MSBNK-Waters-WA002746 |
| Version | |
| Author | |
| Maintainer | |
| Language | |
| MetadataPublished | 2016-01-19 |
| Related Molecule |
|
| Field | Value |
|---|---|
| Measurement Technique | liquid chromatography-mass spectrometry |
| Measurement Variables |
| Data-Source Molecule ID | Data-Source |
|---|---|
| PD003202 | ProbesDrugs |
| 6PLQ3CP4P3 | FDA SRS |
| etoposide | Atlas |
| LSM-6348 | LINCS |
| 121471-01-0 | ACToR |
| Etopophos | Selleck |
| 14935915 | PubChem: Thomson Pharma |
| 14886949 | PubChem: Thomson Pharma |
| 36462 | PubChem |
| 32278021 | eMolecules |
| 537894 | eMolecules |
| ZINC000003938684 | ZINC |
| PA449552 | PharmGKB |
| 98367 | Brenda |
| 21602 | Brenda |
| 154445 | Brenda |
| 153455 | Brenda |
| 49045 | Brenda |
| 92457 | Brenda |
| 774 | Brenda |
| 147647 | Brenda |
| HMDB0014911 | Human Metabolome Database |
| etoposide | DailyMed |
| SCHEMBL4259 | SureChEMBL |
| CHEMBL44657 | ChEMBL |
| DB00773 | DrugBank |
| 12013288 | PubChem: Drugs of the Future |
| C01576 | KEGG Ligand |
| EVP | PDBe |
| SAM001246880 | NIH Clinical Collection |
| 4911 | ChEBI |
| 6815 | Guide to Pharmacology |
| J3.178J | Nikkaji |
| LEZREO | CCDC |
| 229441 | Brenda |
| ETOPOSIDE | DailyMed |
| TOPOSAR | rxnorm |
| ETOPOSIDE | rxnorm |
| 50127140 | BindingDB |
| TOPOSAR | clinicaltrials |
| ETOPOSIDE | clinicaltrials |
| VP-16-213 | clinicaltrials |
| NSC-141540 | clinicaltrials |
| VEPESID | clinicaltrials |
| HY-13629 | MedChemExpress |
| 229442 | Brenda |
| 1112 | DrugCentral |
| The data in this table is sourced from UniChem at EBI. | |